C15H20N2O3 — CID 174582401
[(3R)-3,4-dimethyl-2-oxo-6-phenylpiperazin-1-yl] propanoate (PubChem CID 174582401) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is [(3R)-3,4-dimethyl-2-oxo-6-phenylpiperazin-1-yl] propanoate.
| Compound Name | [(3R)-3,4-dimethyl-2-oxo-6-phenylpiperazin-1-yl] propanoate |
|---|---|
| PubChem CID | 174582401 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [(3R)-3,4-dimethyl-2-oxo-6-phenylpiperazin-1-yl] propanoate |
| SMILES | CCC(=O)ON1C(=O)[C@@H](C)N(C)CC1c1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c1-4-14(18)20-17-13(12-8-6-5-7-9-12)10-16(3)11(2)15(17)19/h5-9,11,13H,4,10H2,1-3H3/t11-,13?/m1/s1 |
| InChIKey | NAGUESRMLWILBL-JTDNENJMSA-N |
| XLogP | 1.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |