C15H11BrN6O2 — CID 174583294
3-(bromomethyl)-5-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)-1H-pyridin-2-yl]-1,2,4-oxadiazole (PubChem CID 174583294) has the molecular formula C15H11BrN6O2 and a molecular weight of 387.20 g/mol. Its IUPAC name is 3-(bromomethyl)-5-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)-1H-pyridin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(bromomethyl)-5-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)-1H-pyridin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 174583294 |
| Molecular Formula | C15H11BrN6O2 |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 3-(bromomethyl)-5-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)-1H-pyridin-2-yl]-1,2,4-oxadiazole |
| SMILES | BrCc1noc(C2(c3noc(-c4ccccn4)n3)C=CC=CN2)n1 |
| InChI | InChI=1S/C15H11BrN6O2/c16-9-11-19-14(24-21-11)15(6-2-4-8-18-15)13-20-12(23-22-13)10-5-1-3-7-17-10/h1-8,18H,9H2 |
| InChIKey | OGUKUNBKRAPGPN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|