C20H30ClN3O6 — CID 174584560
tert-butyl formate;2-chloro-5-nitro-N-piperidin-4-yl-4-propan-2-yloxybenzamide (PubChem CID 174584560) has the molecular formula C20H30ClN3O6 and a molecular weight of 443.93 g/mol. Its IUPAC name is tert-butyl formate;2-chloro-5-nitro-N-piperidin-4-yl-4-propan-2-yloxybenzamide.
| Compound Name | tert-butyl formate;2-chloro-5-nitro-N-piperidin-4-yl-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 174584560 |
| Molecular Formula | C20H30ClN3O6 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | tert-butyl formate;2-chloro-5-nitro-N-piperidin-4-yl-4-propan-2-yloxybenzamide |
| SMILES | CC(C)(C)OC=O.CC(C)Oc1cc(Cl)c(C(=O)NC2CCNCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20ClN3O4.C5H10O2/c1-9(2)23-14-8-12(16)11(7-13(14)19(21)22)15(20)18-10-3-5-17-6-4-10;1-5(2,3)7-4-6/h7-10,17H,3-6H2,1-2H3,(H,18,20);4H,1-3H3 |
| InChIKey | YEHBKYHDWSYIOB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|