C21H17Cl2N3O4 — CID 174584730
5-[3-chloro-5-[5-(3-chloro-4-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]indol-1-yl]pentanoic acid (PubChem CID 174584730) has the molecular formula C21H17Cl2N3O4 and a molecular weight of 446.29 g/mol. Its IUPAC name is 5-[3-chloro-5-[5-(3-chloro-4-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]indol-1-yl]pentanoic acid.
| Compound Name | 5-[3-chloro-5-[5-(3-chloro-4-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]indol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 174584730 |
| Molecular Formula | C21H17Cl2N3O4 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 5-[3-chloro-5-[5-(3-chloro-4-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]indol-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCn1cc(Cl)c2cc(-c3noc(-c4ccc(O)c(Cl)c4)n3)ccc21 |
| InChI | InChI=1S/C21H17Cl2N3O4/c22-15-10-13(5-7-18(15)27)21-24-20(25-30-21)12-4-6-17-14(9-12)16(23)11-26(17)8-2-1-3-19(28)29/h4-7,9-11,27H,1-3,8H2,(H,28,29) |
| InChIKey | SGCNJTLGWWMTIS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|