C24H25ClN4O3 — CID 158955697
3-[2-[3-[5-(3-chloro-1-propan-2-ylindol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]propanoic acid (PubChem CID 158955697) has the molecular formula C24H25ClN4O3 and a molecular weight of 452.94 g/mol. Its IUPAC name is 3-[2-[3-[5-(3-chloro-1-propan-2-ylindol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]propanoic acid.
| Compound Name | 3-[2-[3-[5-(3-chloro-1-propan-2-ylindol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 158955697 |
| Molecular Formula | C24H25ClN4O3 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 3-[2-[3-[5-(3-chloro-1-propan-2-ylindol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]propanoic acid |
| SMILES | CC(C)n1cc(Cl)c2cc(-c3nc(-c4cccc(CCNCCC(=O)O)c4)no3)ccc21 |
| InChI | InChI=1S/C24H25ClN4O3/c1-15(2)29-14-20(25)19-13-18(6-7-21(19)29)24-27-23(28-32-24)17-5-3-4-16(12-17)8-10-26-11-9-22(30)31/h3-7,12-15,26H,8-11H2,1-2H3,(H,30,31) |
| InChIKey | JLZAXBBSXWEEQS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|