C25H26ClN3O3 — CID 157411844
5-[3-[5-(3-chloro-1-propan-2-ylindol-5-yl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]pentanoic acid (PubChem CID 157411844) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is 5-[3-[5-(3-chloro-1-propan-2-ylindol-5-yl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]pentanoic acid.
| Compound Name | 5-[3-[5-(3-chloro-1-propan-2-ylindol-5-yl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]pentanoic acid |
|---|---|
| PubChem CID | 157411844 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 5-[3-[5-(3-chloro-1-propan-2-ylindol-5-yl)-1,2,4-oxadiazol-3-yl]-2-methylphenyl]pentanoic acid |
| SMILES | Cc1c(CCCCC(=O)O)cccc1-c1noc(-c2ccc3c(c2)c(Cl)cn3C(C)C)n1 |
| InChI | InChI=1S/C25H26ClN3O3/c1-15(2)29-14-21(26)20-13-18(11-12-22(20)29)25-27-24(28-32-25)19-9-6-8-17(16(19)3)7-4-5-10-23(30)31/h6,8-9,11-15H,4-5,7,10H2,1-3H3,(H,30,31) |
| InChIKey | BOJLZNCLQFDJDD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|