C11H15N5O2 — CID 174585429
6-(4-hydroxypiperidin-1-yl)-8,9-dihydro-7H-purine-8-carbaldehyde (PubChem CID 174585429) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 6-(4-hydroxypiperidin-1-yl)-8,9-dihydro-7H-purine-8-carbaldehyde.
| Compound Name | 6-(4-hydroxypiperidin-1-yl)-8,9-dihydro-7H-purine-8-carbaldehyde |
|---|---|
| PubChem CID | 174585429 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 6-(4-hydroxypiperidin-1-yl)-8,9-dihydro-7H-purine-8-carbaldehyde |
| SMILES | O=CC1Nc2ncnc(N3CCC(O)CC3)c2N1 |
| InChI | InChI=1S/C11H15N5O2/c17-5-8-14-9-10(15-8)12-6-13-11(9)16-3-1-7(18)2-4-16/h5-8,14,18H,1-4H2,(H,12,13,15) |
| InChIKey | ZTWZHSLEXVGNLI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|