C27H52O5 — CID 174586354
2,3-dihydroxypropyl octadecanoate;(2E,4E)-hexa-2,4-dien-1-ol (PubChem CID 174586354) has the molecular formula C27H52O5 and a molecular weight of 456.71 g/mol. Its IUPAC name is 2,3-dihydroxypropyl octadecanoate;(2E,4E)-hexa-2,4-dien-1-ol.
| Compound Name | 2,3-dihydroxypropyl octadecanoate;(2E,4E)-hexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 174586354 |
| Molecular Formula | C27H52O5 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | 2,3-dihydroxypropyl octadecanoate;(2E,4E)-hexa-2,4-dien-1-ol |
| SMILES | C/C=C/C=C/CO.CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H42O4.C6H10O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;1-2-3-4-5-6-7/h20,22-23H,2-19H2,1H3;2-5,7H,6H2,1H3/b;3-2+,5-4+ |
| InChIKey | YQVDDKCNVIHGMH-PLKIVWSFSA-N |
| XLogP | 6.26 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|