C9H14BrNS — CID 174586492
4-(2-bromohexyl)-1,3-thiazole (PubChem CID 174586492) has the molecular formula C9H14BrNS and a molecular weight of 248.19 g/mol. Its IUPAC name is 4-(2-bromohexyl)-1,3-thiazole.
| Compound Name | 4-(2-bromohexyl)-1,3-thiazole |
|---|---|
| PubChem CID | 174586492 |
| Molecular Formula | C9H14BrNS |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 4-(2-bromohexyl)-1,3-thiazole |
| SMILES | CCCCC(Br)Cc1cscn1 |
| InChI | InChI=1S/C9H14BrNS/c1-2-3-4-8(10)5-9-6-12-7-11-9/h6-8H,2-5H2,1H3 |
| InChIKey | BOALSIXSPLAMGS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|