C3H9O7PS — CID 174589208
phosphoric acid;prop-1-ene-2-sulfonic acid (PubChem CID 174589208) has the molecular formula C3H9O7PS and a molecular weight of 220.14 g/mol. Its IUPAC name is phosphoric acid;prop-1-ene-2-sulfonic acid.
| Compound Name | phosphoric acid;prop-1-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 174589208 |
| Molecular Formula | C3H9O7PS |
| Molecular Weight | 220.14 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | phosphoric acid;prop-1-ene-2-sulfonic acid |
| SMILES | C=C(C)S(=O)(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C3H6O3S.H3O4P/c1-3(2)7(4,5)6;1-5(2,3)4/h1H2,2H3,(H,4,5,6);(H3,1,2,3,4) |
| InChIKey | SFBBRVYHBUGXGE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.14 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|