C12H22O5 — CID 174589839
2-hydroxy-2-octan-3-ylbutanedioic acid (PubChem CID 174589839) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is 2-hydroxy-2-octan-3-ylbutanedioic acid.
| Compound Name | 2-hydroxy-2-octan-3-ylbutanedioic acid |
|---|---|
| PubChem CID | 174589839 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-hydroxy-2-octan-3-ylbutanedioic acid |
| SMILES | CCCCCC(CC)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H22O5/c1-3-5-6-7-9(4-2)12(17,11(15)16)8-10(13)14/h9,17H,3-8H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | LYAKFUFMFHHLRH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|