C20H34O8 — CID 87175839
2-[1-(3,4-diethyloctan-3-yloxy)-1,3-dioxobutan-2-yl]-2-hydroxybutanedioic acid (PubChem CID 87175839) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-[1-(3,4-diethyloctan-3-yloxy)-1,3-dioxobutan-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[1-(3,4-diethyloctan-3-yloxy)-1,3-dioxobutan-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87175839 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-[1-(3,4-diethyloctan-3-yloxy)-1,3-dioxobutan-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCC(CC)C(CC)(CC)OC(=O)C(C(C)=O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H34O8/c1-6-10-11-14(7-2)19(8-3,9-4)28-17(24)16(13(5)21)20(27,18(25)26)12-15(22)23/h14,16,27H,6-12H2,1-5H3,(H,22,23)(H,25,26) |
| InChIKey | QGSXRVALBPRIGW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|