C16H26O8 — CID 87579631
2-[2-(4-ethyl-2-oxooctan-3-yl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 87579631) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[2-(4-ethyl-2-oxooctan-3-yl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(4-ethyl-2-oxooctan-3-yl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87579631 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[2-(4-ethyl-2-oxooctan-3-yl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | CCCCC(CC)C(OC(=O)CC(O)(CC(=O)O)C(=O)O)C(C)=O |
| InChI | InChI=1S/C16H26O8/c1-4-6-7-11(5-2)14(10(3)17)24-13(20)9-16(23,15(21)22)8-12(18)19/h11,14,23H,4-9H2,1-3H3,(H,18,19)(H,21,22) |
| InChIKey | JJHAVEZWJHDLIT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |