C14H28O7S2 — CID 174591214
ethane-1,2-diol;2-methyl-3-(2-methylprop-2-enoxy)prop-1-ene;bis(2-sulfanylacetic acid) (PubChem CID 174591214) has the molecular formula C14H28O7S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is ethane-1,2-diol;2-methyl-3-(2-methylprop-2-enoxy)prop-1-ene;bis(2-sulfanylacetic acid).
| Compound Name | ethane-1,2-diol;2-methyl-3-(2-methylprop-2-enoxy)prop-1-ene;bis(2-sulfanylacetic acid) |
|---|---|
| PubChem CID | 174591214 |
| Molecular Formula | C14H28O7S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | ethane-1,2-diol;2-methyl-3-(2-methylprop-2-enoxy)prop-1-ene;bis(2-sulfanylacetic acid) |
| SMILES | C=C(C)COCC(=C)C.O=C(O)CS.O=C(O)CS.OCCO |
| InChI | InChI=1S/C8H14O.2C2H4O2S.C2H6O2/c1-7(2)5-9-6-8(3)4;2*3-2(4)1-5;3-1-2-4/h1,3,5-6H2,2,4H3;2*5H,1H2,(H,3,4);3-4H,1-2H2 |
| InChIKey | YKRDHYMBJAOQTK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|