C22H20F3N3O2 — CID 174592138
2-ethyl-5-[[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methoxy]-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 174592138) has the molecular formula C22H20F3N3O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 2-ethyl-5-[[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methoxy]-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | 2-ethyl-5-[[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methoxy]-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174592138 |
| Molecular Formula | C22H20F3N3O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-ethyl-5-[[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methoxy]-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | CCN1Cc2cc(OCc3cn[nH]c3-c3cccc(C(F)(F)F)c3)ccc2C1C=O |
| InChI | InChI=1S/C22H20F3N3O2/c1-2-28-11-15-9-18(6-7-19(15)20(28)12-29)30-13-16-10-26-27-21(16)14-4-3-5-17(8-14)22(23,24)25/h3-10,12,20H,2,11,13H2,1H3,(H,26,27) |
| InChIKey | RJXUMZVUAKPXGM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|