C24H27N3O2 — CID 174606935
2-(3-methylbutyl)-5-[(5-phenyl-1H-pyrazol-4-yl)methoxy]-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 174606935) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-(3-methylbutyl)-5-[(5-phenyl-1H-pyrazol-4-yl)methoxy]-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | 2-(3-methylbutyl)-5-[(5-phenyl-1H-pyrazol-4-yl)methoxy]-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174606935 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 2-(3-methylbutyl)-5-[(5-phenyl-1H-pyrazol-4-yl)methoxy]-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | CC(C)CCN1Cc2cc(OCc3cn[nH]c3-c3ccccc3)ccc2C1C=O |
| InChI | InChI=1S/C24H27N3O2/c1-17(2)10-11-27-14-19-12-21(8-9-22(19)23(27)15-28)29-16-20-13-25-26-24(20)18-6-4-3-5-7-18/h3-9,12-13,15,17,23H,10-11,14,16H2,1-2H3,(H,25,26) |
| InChIKey | VLIAMWOIVZNTRS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|