C15H17BrClNO2 — CID 174593602
[5-(2-bromoethyl)-6-chloro-1H-indol-3-yl] 2,2-dimethylpropanoate (PubChem CID 174593602) has the molecular formula C15H17BrClNO2 and a molecular weight of 358.66 g/mol. Its IUPAC name is [5-(2-bromoethyl)-6-chloro-1H-indol-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [5-(2-bromoethyl)-6-chloro-1H-indol-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174593602 |
| Molecular Formula | C15H17BrClNO2 |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | [5-(2-bromoethyl)-6-chloro-1H-indol-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1c[nH]c2cc(Cl)c(CCBr)cc12 |
| InChI | InChI=1S/C15H17BrClNO2/c1-15(2,3)14(19)20-13-8-18-12-7-11(17)9(4-5-16)6-10(12)13/h6-8,18H,4-5H2,1-3H3 |
| InChIKey | XTWGNLDPDASMNZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|