C28H43N3O6 — CID 174594927
2-[[(2R)-1-[cyclohexyl(methyl)amino]-1,7-dioxo-7-phenylmethoxyheptan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 174594927) has the molecular formula C28H43N3O6 and a molecular weight of 517.67 g/mol. Its IUPAC name is 2-[[(2R)-1-[cyclohexyl(methyl)amino]-1,7-dioxo-7-phenylmethoxyheptan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | 2-[[(2R)-1-[cyclohexyl(methyl)amino]-1,7-dioxo-7-phenylmethoxyheptan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 174594927 |
| Molecular Formula | C28H43N3O6 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | 2-[[(2R)-1-[cyclohexyl(methyl)amino]-1,7-dioxo-7-phenylmethoxyheptan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | CCCCC(NC(=O)N[C@H](CCCCC(=O)OCc1ccccc1)C(=O)N(C)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C28H43N3O6/c1-3-4-17-24(27(34)35)30-28(36)29-23(26(33)31(2)22-15-9-6-10-16-22)18-11-12-19-25(32)37-20-21-13-7-5-8-14-21/h5,7-8,13-14,22-24H,3-4,6,9-12,15-20H2,1-2H3,(H,34,35)(H2,29,30,36)/t23-,24?/m1/s1 |
| InChIKey | SDELLNXIGJXBBO-MIHMCVIASA-N |
| XLogP | 4.39 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|