C19H27N5O — CID 174595402
5-propan-2-yl-2-[2,4,6-tris(methylamino)anilino]benzamide (PubChem CID 174595402) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 5-propan-2-yl-2-[2,4,6-tris(methylamino)anilino]benzamide.
| Compound Name | 5-propan-2-yl-2-[2,4,6-tris(methylamino)anilino]benzamide |
|---|---|
| PubChem CID | 174595402 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 5-propan-2-yl-2-[2,4,6-tris(methylamino)anilino]benzamide |
| SMILES | CNc1cc(NC)c(Nc2ccc(C(C)C)cc2C(N)=O)c(NC)c1 |
| InChI | InChI=1S/C19H27N5O/c1-11(2)12-6-7-15(14(8-12)19(20)25)24-18-16(22-4)9-13(21-3)10-17(18)23-5/h6-11,21-24H,1-5H3,(H2,20,25) |
| InChIKey | ICWUDZYAQOUIED-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|