C21H27N7O — CID 174595415
5-(2-ethylpyrazol-3-yl)-2-[2,4,6-tris(methylamino)anilino]benzamide (PubChem CID 174595415) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 5-(2-ethylpyrazol-3-yl)-2-[2,4,6-tris(methylamino)anilino]benzamide.
| Compound Name | 5-(2-ethylpyrazol-3-yl)-2-[2,4,6-tris(methylamino)anilino]benzamide |
|---|---|
| PubChem CID | 174595415 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 5-(2-ethylpyrazol-3-yl)-2-[2,4,6-tris(methylamino)anilino]benzamide |
| SMILES | CCn1nccc1-c1ccc(Nc2c(NC)cc(NC)cc2NC)c(C(N)=O)c1 |
| InChI | InChI=1S/C21H27N7O/c1-5-28-19(8-9-26-28)13-6-7-16(15(10-13)21(22)29)27-20-17(24-3)11-14(23-2)12-18(20)25-4/h6-12,23-25,27H,5H2,1-4H3,(H2,22,29) |
| InChIKey | VMWBZXNXGOFGQQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 109.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|