C16H26O2Si — CID 174598655
3-benzyl-3-dimethylsilyloxy-4,4-dimethylpentan-2-one (PubChem CID 174598655) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is 3-benzyl-3-dimethylsilyloxy-4,4-dimethylpentan-2-one.
| Compound Name | 3-benzyl-3-dimethylsilyloxy-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 174598655 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-benzyl-3-dimethylsilyloxy-4,4-dimethylpentan-2-one |
| SMILES | CC(=O)C(Cc1ccccc1)(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C16H26O2Si/c1-13(17)16(15(2,3)4,18-19(5)6)12-14-10-8-7-9-11-14/h7-11,19H,12H2,1-6H3 |
| InChIKey | QKJMOSKBIQSOMT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|