C15H20N2O5 — CID 91157706
methyl 2-[[(2R)-2-amino-2-benzyl-3-oxobutanoyl]amino]-2-methoxyacetate (PubChem CID 91157706) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-amino-2-benzyl-3-oxobutanoyl]amino]-2-methoxyacetate.
| Compound Name | methyl 2-[[(2R)-2-amino-2-benzyl-3-oxobutanoyl]amino]-2-methoxyacetate |
|---|---|
| PubChem CID | 91157706 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | methyl 2-[[(2R)-2-amino-2-benzyl-3-oxobutanoyl]amino]-2-methoxyacetate |
| SMILES | COC(=O)C(NC(=O)[C@@](N)(Cc1ccccc1)C(C)=O)OC |
| InChI | InChI=1S/C15H20N2O5/c1-10(18)15(16,9-11-7-5-4-6-8-11)14(20)17-12(21-2)13(19)22-3/h4-8,12H,9,16H2,1-3H3,(H,17,20)/t12?,15-/m1/s1 |
| InChIKey | IXKBNNOERHMHBW-WPZCJLIBSA-N |
| XLogP | -0.22 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|