C20H22N2O6 — CID 57208458
[2-methoxy-2-(phenylmethoxycarbonylamino)acetyl] (2S)-2-amino-3-phenylpropanoate (PubChem CID 57208458) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is [2-methoxy-2-(phenylmethoxycarbonylamino)acetyl] (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [2-methoxy-2-(phenylmethoxycarbonylamino)acetyl] (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 57208458 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [2-methoxy-2-(phenylmethoxycarbonylamino)acetyl] (2S)-2-amino-3-phenylpropanoate |
| SMILES | COC(NC(=O)OCc1ccccc1)C(=O)OC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O6/c1-26-17(22-20(25)27-13-15-10-6-3-7-11-15)19(24)28-18(23)16(21)12-14-8-4-2-5-9-14/h2-11,16-17H,12-13,21H2,1H3,(H,22,25)/t16-,17?/m0/s1 |
| InChIKey | MPUVXSBXGCJJPI-BHWOMJMDSA-N |
| XLogP | 1.53 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|