C24H30O3P+ — CID 174599308
ethoxy-formyl-diphenylphosphanium;1,3,5-trimethylbenzene;hydrate (PubChem CID 174599308) has the molecular formula C24H30O3P+ and a molecular weight of 397.48 g/mol. Its IUPAC name is ethoxy-formyl-diphenylphosphanium;1,3,5-trimethylbenzene;hydrate.
| Compound Name | ethoxy-formyl-diphenylphosphanium;1,3,5-trimethylbenzene;hydrate |
|---|---|
| PubChem CID | 174599308 |
| Molecular Formula | C24H30O3P+ |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | ethoxy-formyl-diphenylphosphanium;1,3,5-trimethylbenzene;hydrate |
| SMILES | CCO[P+](C=O)(c1ccccc1)c1ccccc1.Cc1cc(C)cc(C)c1.O |
| InChI | InChI=1S/C15H16O2P.C9H12.H2O/c1-2-17-18(13-16,14-9-5-3-6-10-14)15-11-7-4-8-12-15;1-7-4-8(2)6-9(3)5-7;/h3-13H,2H2,1H3;4-6H,1-3H3;1H2/q+1;; |
| InChIKey | BPEXGYLZOWCMBT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|