C20H20O — CID 174599880
2-[3-(3-phenylphenyl)propyl]penta-3,4-dienal (PubChem CID 174599880) has the molecular formula C20H20O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[3-(3-phenylphenyl)propyl]penta-3,4-dienal.
| Compound Name | 2-[3-(3-phenylphenyl)propyl]penta-3,4-dienal |
|---|---|
| PubChem CID | 174599880 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-[3-(3-phenylphenyl)propyl]penta-3,4-dienal |
| SMILES | C=C=CC(C=O)CCCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H20O/c1-2-8-18(16-21)11-6-9-17-10-7-14-20(15-17)19-12-4-3-5-13-19/h3-5,7-8,10,12-16,18H,1,6,9,11H2 |
| InChIKey | QFARBFNSEXTADO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|