C22H30ClN3O4 — CID 174600068
[4-[1-(3-chlorophenyl)-4-(2,3-dioxopiperazin-1-yl)cyclohexyl]-2-methylbutan-2-yl] carbamate (PubChem CID 174600068) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is [4-[1-(3-chlorophenyl)-4-(2,3-dioxopiperazin-1-yl)cyclohexyl]-2-methylbutan-2-yl] carbamate.
| Compound Name | [4-[1-(3-chlorophenyl)-4-(2,3-dioxopiperazin-1-yl)cyclohexyl]-2-methylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 174600068 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | [4-[1-(3-chlorophenyl)-4-(2,3-dioxopiperazin-1-yl)cyclohexyl]-2-methylbutan-2-yl] carbamate |
| SMILES | CC(C)(CCC1(c2cccc(Cl)c2)CCC(N2CCNC(=O)C2=O)CC1)OC(N)=O |
| InChI | InChI=1S/C22H30ClN3O4/c1-21(2,30-20(24)29)10-11-22(15-4-3-5-16(23)14-15)8-6-17(7-9-22)26-13-12-25-18(27)19(26)28/h3-5,14,17H,6-13H2,1-2H3,(H2,24,29)(H,25,27) |
| InChIKey | BMEAAPIGDBFEED-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|