C18H24ClNO3 — CID 151770932
[4-[1-(3-chlorophenyl)-4-oxocyclohexyl]-2-methylbutan-2-yl] carbamate (PubChem CID 151770932) has the molecular formula C18H24ClNO3 and a molecular weight of 337.85 g/mol. Its IUPAC name is [4-[1-(3-chlorophenyl)-4-oxocyclohexyl]-2-methylbutan-2-yl] carbamate.
| Compound Name | [4-[1-(3-chlorophenyl)-4-oxocyclohexyl]-2-methylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 151770932 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [4-[1-(3-chlorophenyl)-4-oxocyclohexyl]-2-methylbutan-2-yl] carbamate |
| SMILES | CC(C)(CCC1(c2cccc(Cl)c2)CCC(=O)CC1)OC(N)=O |
| InChI | InChI=1S/C18H24ClNO3/c1-17(2,23-16(20)22)10-11-18(8-6-15(21)7-9-18)13-4-3-5-14(19)12-13/h3-5,12H,6-11H2,1-2H3,(H2,20,22) |
| InChIKey | RSOJOJNAGMCXBR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |