C20H28FN3O4S2 — CID 174600617
2-fluoro-4-methylsulfonyl-N-[(2-piperidin-4-yl-1,3-thiazol-4-yl)methyl]aniline;propan-2-yl formate (PubChem CID 174600617) has the molecular formula C20H28FN3O4S2 and a molecular weight of 457.59 g/mol. Its IUPAC name is 2-fluoro-4-methylsulfonyl-N-[(2-piperidin-4-yl-1,3-thiazol-4-yl)methyl]aniline;propan-2-yl formate.
| Compound Name | 2-fluoro-4-methylsulfonyl-N-[(2-piperidin-4-yl-1,3-thiazol-4-yl)methyl]aniline;propan-2-yl formate |
|---|---|
| PubChem CID | 174600617 |
| Molecular Formula | C20H28FN3O4S2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-fluoro-4-methylsulfonyl-N-[(2-piperidin-4-yl-1,3-thiazol-4-yl)methyl]aniline;propan-2-yl formate |
| SMILES | CC(C)OC=O.CS(=O)(=O)c1ccc(NCc2csc(C3CCNCC3)n2)c(F)c1 |
| InChI | InChI=1S/C16H20FN3O2S2.C4H8O2/c1-24(21,22)13-2-3-15(14(17)8-13)19-9-12-10-23-16(20-12)11-4-6-18-7-5-11;1-4(2)6-3-5/h2-3,8,10-11,18-19H,4-7,9H2,1H3;3-4H,1-2H3 |
| InChIKey | UVFXAWSVVFGZMM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|