C8H17NaO3 — CID 174603299
sodium;2-(2,2-dimethylpropoxy)ethyl formate;hydride (PubChem CID 174603299) has the molecular formula C8H17NaO3 and a molecular weight of 184.21 g/mol. Its IUPAC name is sodium;2-(2,2-dimethylpropoxy)ethyl formate;hydride.
| Compound Name | sodium;2-(2,2-dimethylpropoxy)ethyl formate;hydride |
|---|---|
| PubChem CID | 174603299 |
| Molecular Formula | C8H17NaO3 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | sodium;2-(2,2-dimethylpropoxy)ethyl formate;hydride |
| SMILES | CC(C)(C)COCCOC=O.[H-].[Na+] |
| InChI | InChI=1S/C8H16O3.Na.H/c1-8(2,3)6-10-4-5-11-7-9;;/h7H,4-6H2,1-3H3;;/q;+1;-1 |
| InChIKey | KMWXEUMHPRTCQS-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|