C21H24N2O2 — CID 174604963
2-[1-(2,3-dihydro-1H-indol-4-yl)piperidin-3-yl]-2-phenylacetic acid (PubChem CID 174604963) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[1-(2,3-dihydro-1H-indol-4-yl)piperidin-3-yl]-2-phenylacetic acid.
| Compound Name | 2-[1-(2,3-dihydro-1H-indol-4-yl)piperidin-3-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 174604963 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[1-(2,3-dihydro-1H-indol-4-yl)piperidin-3-yl]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)C1CCCN(c2cccc3c2CCN3)C1 |
| InChI | InChI=1S/C21H24N2O2/c24-21(25)20(15-6-2-1-3-7-15)16-8-5-13-23(14-16)19-10-4-9-18-17(19)11-12-22-18/h1-4,6-7,9-10,16,20,22H,5,8,11-14H2,(H,24,25) |
| InChIKey | XNFGNYTVCUVXCD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |