C29H23NaO2 — CID 174607655
sodium;(9,10-diphenylanthracen-1-yl) propanoate;hydride (PubChem CID 174607655) has the molecular formula C29H23NaO2 and a molecular weight of 426.49 g/mol. Its IUPAC name is sodium;(9,10-diphenylanthracen-1-yl) propanoate;hydride.
| Compound Name | sodium;(9,10-diphenylanthracen-1-yl) propanoate;hydride |
|---|---|
| PubChem CID | 174607655 |
| Molecular Formula | C29H23NaO2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | sodium;(9,10-diphenylanthracen-1-yl) propanoate;hydride |
| SMILES | CCC(=O)Oc1cccc2c(-c3ccccc3)c3ccccc3c(-c3ccccc3)c12.[H-].[Na+] |
| InChI | InChI=1S/C29H22O2.Na.H/c1-2-26(30)31-25-19-11-18-24-27(20-12-5-3-6-13-20)22-16-9-10-17-23(22)28(29(24)25)21-14-7-4-8-15-21;;/h3-19H,2H2,1H3;;/q;+1;-1 |
| InChIKey | AMHYGHUEZOOFAR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|