C29H28O9 — CID 139749700
[5-benzoyl-6,7,8-tri(propanoyloxy)naphthalen-1-yl] propanoate (PubChem CID 139749700) has the molecular formula C29H28O9 and a molecular weight of 520.53 g/mol. Its IUPAC name is [5-benzoyl-6,7,8-tri(propanoyloxy)naphthalen-1-yl] propanoate.
| Compound Name | [5-benzoyl-6,7,8-tri(propanoyloxy)naphthalen-1-yl] propanoate |
|---|---|
| PubChem CID | 139749700 |
| Molecular Formula | C29H28O9 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [5-benzoyl-6,7,8-tri(propanoyloxy)naphthalen-1-yl] propanoate |
| SMILES | CCC(=O)Oc1c(OC(=O)CC)c(OC(=O)CC)c2c(OC(=O)CC)cccc2c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H28O9/c1-5-20(30)35-19-16-12-15-18-24(19)27(36-21(31)6-2)29(38-23(33)8-4)28(37-22(32)7-3)25(18)26(34)17-13-10-9-11-14-17/h9-16H,5-8H2,1-4H3 |
| InChIKey | ZUYQKKOOHTWJSV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|