C27H25ClF7N5O2 — CID 174608414
N-[4-[7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]-2-fluorophenyl]cyclopropanecarboxamide;hydrochloride (PubChem CID 174608414) has the molecular formula C27H25ClF7N5O2 and a molecular weight of 619.97 g/mol. Its IUPAC name is N-[4-[7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]-2-fluorophenyl]cyclopropanecarboxamide;hydrochloride.
| Compound Name | N-[4-[7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]-2-fluorophenyl]cyclopropanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 174608414 |
| Molecular Formula | C27H25ClF7N5O2 |
| Molecular Weight | 619.97 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | N-[4-[7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]-2-fluorophenyl]cyclopropanecarboxamide;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCn2c(C(F)(F)F)nc(-c3ccc(NC(=O)C4CC4)c(F)c3)c2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C27H24F7N5O2.ClH/c28-17-11-19(30)18(29)9-15(17)7-16(35)10-23(40)38-5-6-39-22(12-38)24(37-26(39)27(32,33)34)14-3-4-21(20(31)8-14)36-25(41)13-1-2-13;/h3-4,8-9,11,13,16H,1-2,5-7,10,12,35H2,(H,36,41);1H/t16-;/m1./s1 |
| InChIKey | MONUHYLVTXCCES-PKLMIRHRSA-N |
| XLogP | 5.20 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|