C10H9NO3S — CID 174609443
azane;tricyclo[4.4.0.02,9]deca-1(10),2,4,6,8-pentaene-8-sulfonic acid (PubChem CID 174609443) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is azane;tricyclo[4.4.0.02,9]deca-1(10),2,4,6,8-pentaene-8-sulfonic acid.
| Compound Name | azane;tricyclo[4.4.0.02,9]deca-1(10),2,4,6,8-pentaene-8-sulfonic acid |
|---|---|
| PubChem CID | 174609443 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | azane;tricyclo[4.4.0.02,9]deca-1(10),2,4,6,8-pentaene-8-sulfonic acid |
| SMILES | N.O=S(=O)(O)c1cc2cccc3c1C=c23 |
| InChI | InChI=1S/C10H6O3S.H3N/c11-14(12,13)10-4-6-2-1-3-7-8(6)5-9(7)10;/h1-5H,(H,11,12,13);1H3 |
| InChIKey | UUVJSZRTWYAQTF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|