C11H15N3O — CID 174609991
2-phenyl-1-(1,3,5-triazinan-2-yl)ethanone (PubChem CID 174609991) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-phenyl-1-(1,3,5-triazinan-2-yl)ethanone.
| Compound Name | 2-phenyl-1-(1,3,5-triazinan-2-yl)ethanone |
|---|---|
| PubChem CID | 174609991 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2-phenyl-1-(1,3,5-triazinan-2-yl)ethanone |
| SMILES | O=C(Cc1ccccc1)C1NCNCN1 |
| InChI | InChI=1S/C11H15N3O/c15-10(11-13-7-12-8-14-11)6-9-4-2-1-3-5-9/h1-5,11-14H,6-8H2 |
| InChIKey | QAONAAGQHYYZNT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |