C15H19N — CID 174610229
2-Ethenyl-2-pentylindole (PubChem CID 174610229) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-ethenyl-2-pentylindole.
| Compound Name | 2-Ethenyl-2-pentylindole |
|---|---|
| PubChem CID | 174610229 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-ethenyl-2-pentylindole |
| SMILES | CCCCCC1(C=C2C=CC=CC2=N1)C=C |
| InChI | InChI=1S/C15H19N/c1-3-5-8-11-15(4-2)12-13-9-6-7-10-14(13)16-15/h4,6-7,9-10,12H,2-3,5,8,11H2,1H3 |
| InChIKey | AWTKXHWXSYAEJN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | 396 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|