C7H14N2O3S — CID 174610339
2-methyl-1H-imidazole;propane-1-sulfonic acid (PubChem CID 174610339) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-methyl-1H-imidazole;propane-1-sulfonic acid.
| Compound Name | 2-methyl-1H-imidazole;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174610339 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-methyl-1H-imidazole;propane-1-sulfonic acid |
| SMILES | CCCS(=O)(=O)O.Cc1ncc[nH]1 |
| InChI | InChI=1S/C4H6N2.C3H8O3S/c1-4-5-2-3-6-4;1-2-3-7(4,5)6/h2-3H,1H3,(H,5,6);2-3H2,1H3,(H,4,5,6) |
| InChIKey | CQGWDMCUUCPYSD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|