C6H12N2NaO3S2 — CID 160603614
CID 160603614 (PubChem CID 160603614) has the molecular formula C6H12N2NaO3S2 and a molecular weight of 247.30 g/mol.
| Compound Name | CID 160603614 |
|---|---|
| PubChem CID | 160603614 |
| Molecular Formula | C6H12N2NaO3S2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | — |
| SMILES | CCCS(=O)(=O)O.S=c1[nH]cc[nH]1.[Na] |
| InChI | InChI=1S/C3H4N2S.C3H8O3S.Na/c6-3-4-1-2-5-3;1-2-3-7(4,5)6;/h1-2H,(H2,4,5,6);2-3H2,1H3,(H,4,5,6); |
| InChIKey | REPASPTZFZZCHD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|