About cyclohexyl(dimethyl)silane;methyl prop-2-enoate
cyclohexyl(dimethyl)silane;methyl prop-2-enoate (PubChem CID 174610427) has the molecular formula C12H24O2Si
and a molecular weight of 228.41 g/mol. Its IUPAC name is cyclohexyl(dimethyl)silane;methyl prop-2-enoate.
Molecular Properties
| Compound Name | cyclohexyl(dimethyl)silane;methyl prop-2-enoate |
| PubChem CID | 174610427 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | cyclohexyl(dimethyl)silane;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.C[SiH](C)C1CCCCC1 |
| InChI | InChI=1S/C8H18Si.C4H6O2/c1-9(2)8-6-4-3-5-7-8;1-3-4(5)6-2/h8-9H,3-7H2,1-2H3;3H,1H2,2H3 |
| InChIKey | JWKUJBXQFRQPTO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl(dimethyl)silane;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(dimethyl)silane;methyl prop-2-enoate?
The IUPAC name of cyclohexyl(dimethyl)silane;methyl prop-2-enoate (CID 174610427) is cyclohexyl(dimethyl)silane;methyl prop-2-enoate.
What is the SMILES notation for cyclohexyl(dimethyl)silane;methyl prop-2-enoate?
The canonical SMILES for cyclohexyl(dimethyl)silane;methyl prop-2-enoate is C=CC(=O)OC.C[SiH](C)C1CCCCC1.
What is the InChIKey of cyclohexyl(dimethyl)silane;methyl prop-2-enoate?
The InChIKey is JWKUJBXQFRQPTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18Si.C4H6O2/c1-9(2)8-6-4-3-5-7-8;1-3-4(5)6-2/h8-9H,3-7H2,1-2H3;3H,1H2,2H3.
What are the key properties of cyclohexyl(dimethyl)silane;methyl prop-2-enoate?
cyclohexyl(dimethyl)silane;methyl prop-2-enoate has a molecular weight of 228.41 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(dimethyl)silane;methyl prop-2-enoate is sourced from PubChem (CID 174610427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).