C16H14F2N2O2S2 — CID 17461144
2-(2-amino-2-oxoethyl)sulfanyl-N-[4-(difluoromethylsulfanyl)phenyl]benzamide (PubChem CID 17461144) has the molecular formula C16H14F2N2O2S2 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)sulfanyl-N-[4-(difluoromethylsulfanyl)phenyl]benzamide.
| Compound Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-[4-(difluoromethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17461144 |
| Molecular Formula | C16H14F2N2O2S2 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-[4-(difluoromethylsulfanyl)phenyl]benzamide |
| SMILES | NC(=O)CSc1ccccc1C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C16H14F2N2O2S2/c17-16(18)24-11-7-5-10(6-8-11)20-15(22)12-3-1-2-4-13(12)23-9-14(19)21/h1-8,16H,9H2,(H2,19,21)(H,20,22) |
| InChIKey | AUCKGMJXYQRFST-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |