C28H30N4O2 — CID 174612068
6-(3-methoxyphenyl)-8-[4-(1-methylpiperidin-4-yl)anilino]-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde (PubChem CID 174612068) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-8-[4-(1-methylpiperidin-4-yl)anilino]-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde.
| Compound Name | 6-(3-methoxyphenyl)-8-[4-(1-methylpiperidin-4-yl)anilino]-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 174612068 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 6-(3-methoxyphenyl)-8-[4-(1-methylpiperidin-4-yl)anilino]-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
| SMILES | COc1cccc(-c2cc3c(c(Nc4ccc(C5CCN(C)CC5)cc4)n2)C(C=O)NC=C3)c1 |
| InChI | InChI=1S/C28H30N4O2/c1-32-14-11-20(12-15-32)19-6-8-23(9-7-19)30-28-27-22(10-13-29-26(27)18-33)17-25(31-28)21-4-3-5-24(16-21)34-2/h3-10,13,16-18,20,26,29H,11-12,14-15H2,1-2H3,(H,30,31) |
| InChIKey | GSTLVAZNWIJZHG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|