C27H29N7O3 — CID 174612162
8-[4-(1-acetylpiperidin-4-yl)anilino]-6-(5-amino-6-methoxypyrazin-2-yl)-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde (PubChem CID 174612162) has the molecular formula C27H29N7O3 and a molecular weight of 499.58 g/mol. Its IUPAC name is 8-[4-(1-acetylpiperidin-4-yl)anilino]-6-(5-amino-6-methoxypyrazin-2-yl)-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde.
| Compound Name | 8-[4-(1-acetylpiperidin-4-yl)anilino]-6-(5-amino-6-methoxypyrazin-2-yl)-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 174612162 |
| Molecular Formula | C27H29N7O3 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 8-[4-(1-acetylpiperidin-4-yl)anilino]-6-(5-amino-6-methoxypyrazin-2-yl)-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
| SMILES | COc1nc(-c2cc3c(c(Nc4ccc(C5CCN(C(C)=O)CC5)cc4)n2)C(C=O)NC=C3)cnc1N |
| InChI | InChI=1S/C27H29N7O3/c1-16(36)34-11-8-18(9-12-34)17-3-5-20(6-4-17)31-26-24-19(7-10-29-23(24)15-35)13-21(32-26)22-14-30-25(28)27(33-22)37-2/h3-7,10,13-15,18,23,29H,8-9,11-12H2,1-2H3,(H2,28,30)(H,31,32) |
| InChIKey | SSLGNDGEYJGQML-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|