C15H14Cl2FN3O2 — CID 174612500
[4-amino-3-chloro-6-[4-chloro-3-(dimethylamino)-2-fluorophenyl]-2-pyridinyl]methyl formate (PubChem CID 174612500) has the molecular formula C15H14Cl2FN3O2 and a molecular weight of 358.20 g/mol. Its IUPAC name is [4-amino-3-chloro-6-[4-chloro-3-(dimethylamino)-2-fluorophenyl]-2-pyridinyl]methyl formate.
| Compound Name | [4-amino-3-chloro-6-[4-chloro-3-(dimethylamino)-2-fluorophenyl]-2-pyridinyl]methyl formate |
|---|---|
| PubChem CID | 174612500 |
| Molecular Formula | C15H14Cl2FN3O2 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | [4-amino-3-chloro-6-[4-chloro-3-(dimethylamino)-2-fluorophenyl]-2-pyridinyl]methyl formate |
| SMILES | CN(C)c1c(Cl)ccc(-c2cc(N)c(Cl)c(COC=O)n2)c1F |
| InChI | InChI=1S/C15H14Cl2FN3O2/c1-21(2)15-9(16)4-3-8(14(15)18)11-5-10(19)13(17)12(20-11)6-23-7-22/h3-5,7H,6H2,1-2H3,(H2,19,20) |
| InChIKey | ODUGTXMRRGPNJK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|