C20H19FN4O2 — CID 174613678
9-amino-2-ethyl-6-fluoro-5-(4-methoxy-3-pyridinyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde (PubChem CID 174613678) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is 9-amino-2-ethyl-6-fluoro-5-(4-methoxy-3-pyridinyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde.
| Compound Name | 9-amino-2-ethyl-6-fluoro-5-(4-methoxy-3-pyridinyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 174613678 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 9-amino-2-ethyl-6-fluoro-5-(4-methoxy-3-pyridinyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde |
| SMILES | CCN1Cc2nc3c(-c4cnccc4OC)c(F)ccc3c(N)c2C1C=O |
| InChI | InChI=1S/C20H19FN4O2/c1-3-25-9-14-18(15(25)10-26)19(22)11-4-5-13(21)17(20(11)24-14)12-8-23-7-6-16(12)27-2/h4-8,10,15H,3,9H2,1-2H3,(H2,22,24) |
| InChIKey | GJTNQTLGRSTTHV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|