C21H19F2N3O2 — CID 175264869
9-amino-2-ethyl-6-fluoro-5-(2-fluoro-6-methoxyphenyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde (PubChem CID 175264869) has the molecular formula C21H19F2N3O2 and a molecular weight of 383.40 g/mol. Its IUPAC name is 9-amino-2-ethyl-6-fluoro-5-(2-fluoro-6-methoxyphenyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde.
| Compound Name | 9-amino-2-ethyl-6-fluoro-5-(2-fluoro-6-methoxyphenyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 175264869 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 9-amino-2-ethyl-6-fluoro-5-(2-fluoro-6-methoxyphenyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde |
| SMILES | CCN1Cc2nc3c(-c4c(F)cccc4OC)c(F)ccc3c(N)c2C1C=O |
| InChI | InChI=1S/C21H19F2N3O2/c1-3-26-9-14-19(15(26)10-27)20(24)11-7-8-13(23)18(21(11)25-14)17-12(22)5-4-6-16(17)28-2/h4-8,10,15H,3,9H2,1-2H3,(H2,24,25) |
| InChIKey | NOPDIZVFKFPLDN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|