C12H9BrClNO3 — CID 174614725
2-[4-bromo-5-(4-chlorophenyl)-1,2-oxazol-3-yl]ethyl formate (PubChem CID 174614725) has the molecular formula C12H9BrClNO3 and a molecular weight of 330.56 g/mol. Its IUPAC name is 2-[4-bromo-5-(4-chlorophenyl)-1,2-oxazol-3-yl]ethyl formate.
| Compound Name | 2-[4-bromo-5-(4-chlorophenyl)-1,2-oxazol-3-yl]ethyl formate |
|---|---|
| PubChem CID | 174614725 |
| Molecular Formula | C12H9BrClNO3 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 2-[4-bromo-5-(4-chlorophenyl)-1,2-oxazol-3-yl]ethyl formate |
| SMILES | O=COCCc1noc(-c2ccc(Cl)cc2)c1Br |
| InChI | InChI=1S/C12H9BrClNO3/c13-11-10(5-6-17-7-16)15-18-12(11)8-1-3-9(14)4-2-8/h1-4,7H,5-6H2 |
| InChIKey | IRUCKMDHIYVVJY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|