C10H8ClNO2 — CID 97032664
[5-(4-chlorophenyl)-1,2-oxazol-4-yl]methanol (PubChem CID 97032664) has the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,2-oxazol-4-yl]methanol.
| Compound Name | [5-(4-chlorophenyl)-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 97032664 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | [5-(4-chlorophenyl)-1,2-oxazol-4-yl]methanol |
| SMILES | OCc1cnoc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H8ClNO2/c11-9-3-1-7(2-4-9)10-8(6-13)5-12-14-10/h1-5,13H,6H2 |
| InChIKey | YPXMBRZTXHGVPS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |