C12H13ClN2O — CID 65239703
N-[[5-(4-chlorophenyl)-1,2-oxazol-4-yl]methyl]ethanamine (PubChem CID 65239703) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1,2-oxazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[5-(4-chlorophenyl)-1,2-oxazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 65239703 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1,2-oxazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cnoc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O/c1-2-14-7-10-8-15-16-12(10)9-3-5-11(13)6-4-9/h3-6,8,14H,2,7H2,1H3 |
| InChIKey | DXGBMTLHKMOEEL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |