C13H12ClNO3 — CID 22221228
methyl 3-[5-(4-chlorophenyl)-1,2-oxazol-4-yl]propanoate (PubChem CID 22221228) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is methyl 3-[5-(4-chlorophenyl)-1,2-oxazol-4-yl]propanoate.
| Compound Name | methyl 3-[5-(4-chlorophenyl)-1,2-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 22221228 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | methyl 3-[5-(4-chlorophenyl)-1,2-oxazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1cnoc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12ClNO3/c1-17-12(16)7-4-10-8-15-18-13(10)9-2-5-11(14)6-3-9/h2-3,5-6,8H,4,7H2,1H3 |
| InChIKey | FYJNDIOQWUUUOI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |