C18H15ClN6OS — CID 174615200
[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)methanethiol (PubChem CID 174615200) has the molecular formula C18H15ClN6OS and a molecular weight of 398.88 g/mol. Its IUPAC name is [3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)methanethiol.
| Compound Name | [3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)methanethiol |
|---|---|
| PubChem CID | 174615200 |
| Molecular Formula | C18H15ClN6OS |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)methanethiol |
| SMILES | CCn1c(-c2ccncc2)nnc1C(S)c1nc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C18H15ClN6OS/c1-2-25-16(11-6-8-20-9-7-11)22-23-17(25)14(27)18-21-15(24-26-18)12-4-3-5-13(19)10-12/h3-10,14,27H,2H2,1H3 |
| InChIKey | ADIAIRMRHFYTPC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|